117666-96-3 Usage
Description
FMOC-BPA-OH, also known as 9-fluorenylmethoxycarbonyl-3,5-bis(phenyl)-4-aminophenol, is a synthetic reagent with a white to off-white powder appearance. It is widely utilized in the field of organic chemistry and pharmaceutical research due to its unique chemical properties.
Uses
Used in Pharmaceutical Research:
FMOC-BPA-OH is used as a reagent for the identification of potent muscarinic acetylcholine receptor antagonists. These antagonists play a crucial role in the treatment of various neurological and psychiatric disorders, such as Alzheimer's disease, schizophrenia, and chronic obstructive pulmonary disease (COPD). The compound aids in the development of new drugs targeting these receptors, potentially leading to more effective treatments for these conditions.
Used in Organic Chemistry:
In the field of organic chemistry, FMOC-BPA-OH serves as a valuable reagent for the synthesis of various organic compounds. Its unique chemical structure allows for the formation of new bonds and the modification of existing ones, facilitating the creation of novel molecules with potential applications in various industries.
Used in Chemical Synthesis:
FMOC-BPA-OH is also employed in chemical synthesis as a protecting group for amino groups. This function is essential in the synthesis of peptides, proteins, and other biomolecules, as it prevents unwanted side reactions and ensures the selective protection of specific functional groups. The use of FMOC-BPA-OH in this capacity contributes to the development of more efficient and accurate synthetic methods for the production of complex molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 117666-96-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,7,6,6 and 6 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 117666-96:
(8*1)+(7*1)+(6*7)+(5*6)+(4*6)+(3*6)+(2*9)+(1*6)=153
153 % 10 = 3
So 117666-96-3 is a valid CAS Registry Number.
InChI:InChI=1/C31H25NO5/c33-29(21-8-2-1-3-9-21)22-16-14-20(15-17-22)18-28(30(34)35)32-31(36)37-19-27-25-12-6-4-10-23(25)24-11-5-7-13-26(24)27/h1-17,27-28H,18-19H2,(H,32,36)(H,34,35)/t28-/m0/s1