205526-29-0 Usage
Description
FMOC-D-4-IODOPHENYLALANINE, also known as N-Fmoc-4-iodo-D-phenylalanine, is a chemical compound that serves as a crucial building block in various industries due to its unique properties and reactivity. It is characterized by its ability to be incorporated into complex molecular structures, making it a valuable component in organic synthesis.
Uses
Used in Organic Synthesis:
FMOC-D-4-IODOPHENYLALANINE is used as a key intermediate for the synthesis of complex organic molecules. Its unique structure allows for the creation of a wide range of compounds with diverse applications.
Used in Pharmaceutical Industry:
FMOC-D-4-IODOPHENYLALANINE is used as an important raw material in the development of new pharmaceuticals. Its incorporation into drug molecules can enhance their efficacy, selectivity, and overall performance in treating various medical conditions.
Used in Agrochemicals:
In the agrochemical industry, FMOC-D-4-IODOPHENYLALANINE is utilized as a vital component in the synthesis of novel compounds with potential applications in pest control, crop protection, and other agricultural practices.
Used in Dye Industry:
FMOC-D-4-IODOPHENYLALANINE is employed as a key intermediate in the production of various dyes and pigments. Its unique chemical properties contribute to the development of dyes with improved colorfastness, stability, and other desirable characteristics.
Check Digit Verification of cas no
The CAS Registry Mumber 205526-29-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,0,5,5,2 and 6 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 205526-29:
(8*2)+(7*0)+(6*5)+(5*5)+(4*2)+(3*6)+(2*2)+(1*9)=110
110 % 10 = 0
So 205526-29-0 is a valid CAS Registry Number.
InChI:InChI=1/C24H20INO4/c25-16-11-9-15(10-12-16)13-22(23(27)28)26-24(29)30-14-21-19-7-3-1-5-17(19)18-6-2-4-8-20(18)21/h1-12,21-22H,13-14H2,(H,26,29)(H,27,28)/t22-/m1/s1