102268-15-5 Usage
Description
5-Ethylpyridine-2,3-dicarboxylic acid is an organic compound characterized by a pyridine ring with an ethyl group attached at the 5th position and two carboxylic acid groups at the 2nd and 3rd positions. It is a brown solid with unique chemical properties that make it suitable for various applications.
Uses
Used in Chemical Synthesis:
5-Ethylpyridine-2,3-dicarboxylic acid is used as a key building block in the synthesis of a breathable microporous metal-organic framework (MOF). This MOF exhibits reversible contraction and expansion of its pores without compromising the structural integrity of the framework, making it a promising material for various applications, such as gas storage, separation, and catalysis.
Used in Material Science:
In the field of material science, 5-Ethylpyridine-2,3-dicarboxylic acid can be utilized as a component in the development of advanced materials with specific properties. Its unique structure and chemical properties allow it to contribute to the formation of novel materials with potential applications in various industries, such as electronics, pharmaceuticals, and environmental technology.
Used in Pharmaceutical Industry:
5-Ethylpyridine-2,3-dicarboxylic acid may also find applications in the pharmaceutical industry as a precursor or intermediate in the synthesis of various drug molecules. Its chemical properties can be exploited to create new compounds with potential therapeutic effects, contributing to the development of innovative treatments for various diseases and medical conditions.
Used in Environmental Technology:
In environmental technology, 5-Ethylpyridine-2,3-dicarboxylic acid can be employed in the development of materials and processes for pollution control and remediation. Its chemical properties may enable it to be used in the design of materials that can selectively adsorb or degrade pollutants, contributing to the development of more effective and sustainable environmental solutions.
Overall, 5-Ethylpyridine-2,3-dicarboxylic acid is a versatile organic compound with a wide range of potential applications across various industries, including chemical synthesis, material science, pharmaceuticals, and environmental technology. Its unique structure and properties make it a valuable component in the development of innovative materials and processes.
Check Digit Verification of cas no
The CAS Registry Mumber 102268-15-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,2,2,6 and 8 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 102268-15:
(8*1)+(7*0)+(6*2)+(5*2)+(4*6)+(3*8)+(2*1)+(1*5)=85
85 % 10 = 5
So 102268-15-5 is a valid CAS Registry Number.
InChI:InChI=1/C9H9NO4/c1-2-5-3-6(8(11)12)7(9(13)14)10-4-5/h3-4H,2H2,1H3,(H,11,12)(H,13,14)
