104-24-5 Usage
Description
4-Phenylazobenzoyl chloride, also known as 4-(Phenylazo)benzoyl chloride, is an organic compound characterized by its orange-red crystalline powder form. It is a derivative of benzoyl chloride with an azo group attached to the benzene ring, which contributes to its unique chemical properties and potential applications in various fields.
Uses
Used in Organic Synthesis:
4-Phenylazobenzoyl chloride is used as a key intermediate in the synthesis of polyacetylene derivatives. Its azo group facilitates the formation of conjugated systems in the resulting polymers, which are known for their unique electronic, optical, and structural properties.
Used in Polymer Science:
In the field of polymer science, 4-Phenylazobenzoyl chloride is utilized as a monomer for the preparation of conjugated polymers. These polymers have potential applications in various areas, such as organic electronics, optoelectronics, and materials science, due to their tunable properties and functionalities.
Used in Pharmaceutical Industry:
Although not explicitly mentioned in the provided materials, 4-Phenylazobenzoyl chloride may also find applications in the pharmaceutical industry as a building block for the synthesis of drug molecules. Its unique structure and reactivity can be exploited to create novel compounds with potential therapeutic properties.
Used in Dye and Pigment Industry:
Given its vibrant orange-red color, 4-Phenylazobenzoyl chloride could be used as a dye or pigment in various industries, such as textiles, plastics, and coatings. Its intense color and stability may make it a valuable component in the formulation of colored products.
Purification Methods
Crystallise the acid chloride from pet ether (b 60-80o). [Beilstein 16 III 224.]
Check Digit Verification of cas no
The CAS Registry Mumber 104-24-5 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 1,0 and 4 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 104-24:
(5*1)+(4*0)+(3*4)+(2*2)+(1*4)=25
25 % 10 = 5
So 104-24-5 is a valid CAS Registry Number.
InChI:InChI=1/C13H9ClN2O/c14-13(17)10-6-8-12(9-7-10)16-15-11-4-2-1-3-5-11/h1-9H/b16-15+
104-24-5Relevant articles and documents
-
Ladenburg,Fernholz,Wallis
, p. 294,295, 298 (1938)
-
Azobenzene abamectin derivative and preparation method and application thereof
-
Paragraph 0150; 0157-0159, (2021/07/24)
The invention relates to an azobenzene abamectin derivative and preparation and application thereof. Specifically, the invention discloses a compound with a formula (I) or an optical isomer, a cis-trans-isomer or an agricultural pharmacologically acceptable salt thereof, and a preparation method thereof. The invention further discloses an agricultural composition containing the compound and application of the agricultural composition. The derivative has high killing activity on agricultural pests, mites and the like, and can be used for preventing and treating the pests.
