105931-73-5 Usage
Description
1-Bromo-3-fluoro-4-iodobenzene is an organic compound that features a benzene ring with a bromine atom at the 1st position, a fluorine atom at the 3rd position, and an iodine atom at the 4th position. It is a clear colorless to light yellow liquid and is used in various chemical synthesis processes.
Uses
Used in Chemical Synthesis Industry:
1-Bromo-3-fluoro-4-iodobenzene is used as a chemical intermediate for the synthesis of various organic compounds and pharmaceuticals. Its unique structure with multiple halogens allows for versatile reactions and functional group transformations, making it a valuable building block in the development of new molecules and materials.
Check Digit Verification of cas no
The CAS Registry Mumber 105931-73-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,5,9,3 and 1 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 105931-73:
(8*1)+(7*0)+(6*5)+(5*9)+(4*3)+(3*1)+(2*7)+(1*3)=115
115 % 10 = 5
So 105931-73-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H3BrFI/c7-4-1-2-6(9)5(8)3-4/h1-3H