1259-69-4 Usage
Description
(H-CYS-BETANA)2, also known as L-cystine-2-naphthylamide, is an L-cysteine derivative formed by the formal condensation of the carboxy groups of L-cystine with the amino groups from two molecules of 2-naphthylamine. (H-CYS-BETANA)2 exhibits unique structural and functional properties, making it a versatile molecule with potential applications in various fields.
Uses
Used in Pharmaceutical Industry:
(H-CYS-BETANA)2 is used as a pharmaceutical agent for its potential therapeutic effects. Its unique structure allows it to interact with various biological targets, making it a promising candidate for the development of new drugs.
Used in Research Applications:
In the field of scientific research, (H-CYS-BETANA)2 serves as a valuable tool for studying protein structure, function, and interactions. Its ability to bind with specific proteins and macromolecules can provide insights into the molecular mechanisms underlying various biological processes.
Used in Analytical Chemistry:
(H-CYS-BETANA)2 can be employed as a reagent or analytical tool in various chemical assays and techniques. Its unique chemical properties enable selective detection and quantification of specific compounds, contributing to the advancement of analytical chemistry.
Used in Material Science:
The unique structural properties of (H-CYS-BETANA)2 make it a potential candidate for the development of new materials with specific properties. Its ability to form complexes with other molecules can be harnessed to create materials with tailored characteristics for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 1259-69-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,2,5 and 9 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 1259-69:
(6*1)+(5*2)+(4*5)+(3*9)+(2*6)+(1*9)=84
84 % 10 = 4
So 1259-69-4 is a valid CAS Registry Number.
InChI:InChI=1/C26H26N4O2S2/c27-23(25(31)29-21-11-9-17-5-1-3-7-19(17)13-21)15-33-34-16-24(28)26(32)30-22-12-10-18-6-2-4-8-20(18)14-22/h1-14,23-24H,15-16,27-28H2,(H,29,31)(H,30,32)/t23-,24-/m0/s1