14495-51-3 Usage
Description
1-Bromo-4-chloro-2-methylbenzene, also known as 2-Bromo-5-chlorotoluene, is a clear, colorless to slightly orange liquid with distinct chemical properties. It is an aromatic compound derived from the substitution of a benzene ring with a bromine atom at the 1st position, a chlorine atom at the 4th position, and a methyl group at the 2nd position.
Uses
1. Used in Chemical Synthesis:
1-Bromo-4-chloro-2-methylbenzene is used as a key intermediate in the chemical synthesis of various organic compounds. Its unique structure allows for further functionalization and the creation of a wide range of products.
2. Used in Pharmaceutical Industry:
In the pharmaceutical industry, 1-Bromo-4-chloro-2-methylbenzene is used as a building block for the synthesis of various medicinal compounds. Its specific functional groups enable the development of drugs with targeted therapeutic properties.
3. Used in Dye and Pigment Industry:
1-Bromo-4-chloro-2-methylbenzene is utilized as a starting material for the production of dyes and pigments. Its aromatic structure and substituents contribute to the color and stability of the final products.
4. Used in Agrochemical Industry:
In the agrochemical industry, 1-Bromo-4-chloro-2-methylbenzene is employed as a precursor for the development of various agrochemicals, such as pesticides and herbicides. Its chemical properties make it suitable for the creation of effective and targeted compounds.
5. Used in Preparation of 4-chloro-2-methylbenzophenone:
1-Bromo-4-chloro-2-methylbenzene is specifically used in the preparation of 4-chloro-2-methylbenzophenone, which is an important compound in the synthesis of various organic molecules and has applications in different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 14495-51-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,4,4,9 and 5 respectively; the second part has 2 digits, 5 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 14495-51:
(7*1)+(6*4)+(5*4)+(4*9)+(3*5)+(2*5)+(1*1)=113
113 % 10 = 3
So 14495-51-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H6BrCl/c1-5-4-6(9)2-3-7(5)8/h2-4H,1H3
