155789-92-7 Usage
Description
3-Methoxy-2-Nitro-4-Picoline, also known as 3-Methoxy-4-methyl-2-nitropyridine, is an organic compound with the molecular formula C6H6N2O3. It is a versatile intermediate in the synthesis of various biologically active molecules and has significant applications in the pharmaceutical industry due to its unique chemical structure and properties.
Uses
Used in Pharmaceutical Industry:
3-Methoxy-2-Nitro-4-Picoline is used as a synthetic intermediate for the preparation of various biological compounds, particularly non-nucleoside inhibitors of HIV-1 reverse transcriptase. Its application in this field is due to its ability to inhibit the replication of the HIV virus, thus playing a crucial role in the development of antiretroviral drugs.
Used in Synthetic Chemistry:
3-Methoxy-2-Nitro-4-Picoline is also used as a building block in the synthesis of other complex organic molecules, including pharmaceuticals, agrochemicals, and other specialty chemicals. Its unique structure allows for further functionalization and modification, making it a valuable component in the development of new and innovative compounds with diverse applications.
Check Digit Verification of cas no
The CAS Registry Mumber 155789-92-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,5,7,8 and 9 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 155789-92:
(8*1)+(7*5)+(6*5)+(5*7)+(4*8)+(3*9)+(2*9)+(1*2)=187
187 % 10 = 7
So 155789-92-7 is a valid CAS Registry Number.
InChI:InChI=1/C7H8N2O3/c1-5-3-4-8-7(9(10)11)6(5)12-2/h3-4H,1-2H3
155789-92-7Relevant articles and documents
Drug efflux pump inhibitor
-
, (2008/06/13)
A medicament for preventive and/or therapeutic treatment of a microbial infection which comprises as an active ingredient a compound represented by the following general formula (I): wherein, R1 and R2 represent hydrogen atom, a halogen atom, hydroxyl group or the like, W1 represents —CH═CH—, —CH2O—, —CH2CH2— or the like; R3 represents hydrogen atom, a halogen atom, hydroxyl group or an amino group; R4 represents hydrogen atom, a group of —OZ0-4R5 (Z0-4 represents an alkylene group, a fluorine-substituted alkylene group or a single bond, and R5 represents a cyclic alkyl group, an aryl group or the like); W2 represents a single bond or —C(R8)═C(R9)— (R8 and R9 represent hydrogen atom, a halogen atom, a lower alkyl group or the like, Q represents an acidic group, but W2 and Q may together form vinylidenethiazolidinedione or an equivalent heterocyclic ring; m and n represent an integer of 0 to 2, and q represents an integer of 0 to 3.