16404-16-3 Usage
Description
2,6,8-TRICHLORO-7-METHYLPURINE, also known as 3,9-dichloro-1-methyl-6H-purine, is a synthetic chemical compound with the molecular formula C7H5Cl3N4. It is a derivative of purine, characterized by the substitution of chlorine atoms at positions 2, 6, and 8, and a methyl group at position 7. This unique structure endows the compound with distinct properties, making it a valuable tool in research for studying the effects of purine derivatives on biological systems. 2,6,8-TRICHLORO-7-METHYLPURINE exhibits moderate solubility in water and is stable under standard storage conditions.
Uses
Used in Pharmaceutical Research:
2,6,8-TRICHLORO-7-METHYLPURINE is used as a research compound for investigating the effects of purine derivatives on biological systems. Its unique structure allows scientists to explore its interactions with various biological molecules and pathways, potentially leading to the development of new therapeutic agents.
Used in Anticancer Applications:
2,6,8-TRICHLORO-7-METHYLPURINE is used as a potential anti-cancer agent. Studies have been conducted to evaluate its efficacy in targeting cancer cells and inhibiting tumor growth. 2,6,8-TRICHLORO-7-METHYLPURINE's unique chemical structure may offer novel mechanisms of action in cancer treatment, providing new avenues for the development of more effective therapies.
Used in Drug Development:
2,6,8-TRICHLORO-7-METHYLPURINE is used as a component in the development of pharmaceuticals. Its unique properties and potential biological activities make it a promising candidate for the creation of new drugs targeting various diseases and conditions. Further research and development are needed to fully understand its therapeutic potential and optimize its use in pharmaceutical formulations.
Check Digit Verification of cas no
The CAS Registry Mumber 16404-16-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,4,0 and 4 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 16404-16:
(7*1)+(6*6)+(5*4)+(4*0)+(3*4)+(2*1)+(1*6)=83
83 % 10 = 3
So 16404-16-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H3Cl3N4/c1-13-2-3(7)10-5(8)11-4(2)12-6(13)9/h1H3
