22396-77-6 Usage
Description
1-Acetoxy-4-diethylamino-2-butyne, also known as 4-(Diethylamino)but-2-yn-1-yl acetate, is a chemical compound synthesized from propargyl alcohol and bisamine as starting reactants. It possesses unique structural features and functional groups that make it a versatile molecule with potential applications in various fields.
Uses
Used in Pharmaceutical Industry:
1-Acetoxy-4-diethylamino-2-butyne is used as a pharmaceutical intermediate for the synthesis of various active pharmaceutical ingredients. Its unique structure and functional groups enable it to be a key component in the development of new drugs with improved therapeutic properties.
Used in Chemical Synthesis:
1-Acetoxy-4-diethylamino-2-butyne is used as a building block in the synthesis of various organic compounds. Its acetoxy and diethylamino groups provide opportunities for further functionalization and modification, making it a valuable precursor in the preparation of complex organic molecules.
Used in Material Science:
1-Acetoxy-4-diethylamino-2-butyne can be used as a component in the development of new materials with specific properties. Its unique structure and functional groups can contribute to the formation of novel materials with potential applications in various industries, such as electronics, coatings, and adhesives.
Used in Research and Development:
1-Acetoxy-4-diethylamino-2-butyne serves as a valuable research tool for studying the properties and behavior of various chemical systems. Its unique structure and functional groups make it an interesting subject for investigation, leading to a better understanding of chemical reactions and processes.
Check Digit Verification of cas no
The CAS Registry Mumber 22396-77-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,2,3,9 and 6 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 22396-77:
(7*2)+(6*2)+(5*3)+(4*9)+(3*6)+(2*7)+(1*7)=116
116 % 10 = 6
So 22396-77-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H17NO2/c1-4-11(5-2)8-6-7-9-13-10(3)12/h4-5,8-9H2,1-3H3
22396-77-6Relevant articles and documents
CRYSTALLINE OXYBUTYNIN AND PROCESS FOR PREPARING THE SAME
-
Page/Page column 6, (2009/10/30)
The present invention relates to a crystalline oxybutynin base and process for preparing the same. Further, this invention discloses a process for preparing an acid addition salt of oxybutynin employing the crystalline oxybutynin base.
The synthesis and antifungal evaluation of certain acetylenic compounds.
WATERS,WIESE
, p. 112 - 114 (2007/10/04)
-
