245-08-9 Usage
Description
5H-Pyrido[3,2-b]indole is an organic compound with a unique chemical structure that features a fused pyridine and indole ring system. It is known for its potential applications in various fields due to its distinct properties.
Uses
Used in Organic Electroluminescent Devices:
5H-Pyrido[3,2-b]indole is used as a novel aromatic amine compound for enhancing the performance of organic electroluminescent devices. Its unique chemical structure contributes to improved light-emitting properties and overall device efficiency.
Used in Illuminating Devices:
5H-Pyrido[3,2-b]indole is utilized as a key component in illuminating devices, where its light-emitting characteristics are harnessed to provide efficient and long-lasting illumination.
Used in Display Technology:
In the field of display technology, 5H-Pyrido[3,2-b]indole is employed as a crucial component for developing advanced display systems. Its integration into these systems leads to improved image quality, color reproduction, and overall performance.
Check Digit Verification of cas no
The CAS Registry Mumber 245-08-9 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 2,4 and 5 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 245-08:
(5*2)+(4*4)+(3*5)+(2*0)+(1*8)=49
49 % 10 = 9
So 245-08-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H8N2/c1-2-5-9-8(4-1)11-10(13-9)6-3-7-12-11/h1-7,13H
