2458-23-3 Usage
Description
3-Quinolinecarbonitrile, 7-chloro-4-hydroxyis an organic compound with the molecular formula C10H5ClN2O. It is characterized by its quinoline ring structure, which contains a carbonitrile group at the 3-position, a chlorine atom at the 7-position, and a hydroxyl group at the 4-position. 3-Quinolinecarbonitrile, 7-chloro-4-hydroxyis known for its potential applications in the pharmaceutical industry due to its unique chemical properties.
Uses
Used in Pharmaceutical Industry:
3-Quinolinecarbonitrile, 7-chloro-4-hydroxyis used as an intermediate in the synthesis of Hydroxychloroquine 3-Carbonitrile (H783935), which is an analogue of Hydroxychloroquine (B419750). Hydroxychloroquine is a well-known drug with multiple applications, including its use as an antimalarial, antirheumatic, and lupus erythematosus suppressant. The compound 3-Quinolinecarbonitrile, 7-chloro-4-hydroxyplays a crucial role in the development of these medications, contributing to their effectiveness in treating various health conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 2458-23-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,4,5 and 8 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 2458-23:
(6*2)+(5*4)+(4*5)+(3*8)+(2*2)+(1*3)=83
83 % 10 = 3
So 2458-23-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H5ClN2O/c11-7-1-2-8-9(3-7)13-5-6(4-12)10(8)14/h1-3,5H,(H,13,14)
