29608-05-7 Usage
General Description
4-Piperidin-1-ylmethyl-phenylamine is a chemical compound that belongs to the class of organic compounds known as phenylpiperidines. This classification refers to compounds containing a phenylpiperidine skeleton, which consists of a piperidine bound to a phenyl group. As a chemical, it may have various scientific and industrial applications. However, its specific properties such as reactivity, toxicity, and environmental impact would depend on its molecular structure and associated functional groups. It's relevant to note that this chemical does not appear to be widely researched or used, therefore, detailed information about it is limited. As with any chemical substances, proper safety measures should be taken when handling it.
Check Digit Verification of cas no
The CAS Registry Mumber 29608-05-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,9,6,0 and 8 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 29608-05:
(7*2)+(6*9)+(5*6)+(4*0)+(3*8)+(2*0)+(1*5)=127
127 % 10 = 7
So 29608-05-7 is a valid CAS Registry Number.
InChI:InChI=1/C12H18N2/c1-2-4-11(5-3-1)10-14-12-6-8-13-9-7-12/h1-5,12-14H,6-10H2