298-45-3 Usage
Description
(+)-BULBOCAPNINE is an isoquinoline alkaloid that has been isolated from the Corydalis plant. It is known for its inhibitory activity against enzymes such as tyrosine 3-monooxygenase and diamine oxidase, making it a potential candidate for various pharmaceutical applications.
Uses
Used in Pharmaceutical Industry:
(+)-BULBOCAPNINE is used as a bioactive compound for its ability to inhibit specific enzymes, which can be beneficial in the development of drugs targeting various medical conditions. Its inhibitory activity against tyrosine 3-monooxygenase and diamine oxidase may lead to the creation of medications for treating enzyme-related disorders or diseases.
Additionally, due to its natural origin and potential therapeutic properties, (+)-BULBOCAPNINE could be further researched and utilized in the development of novel drugs or therapies in the pharmaceutical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 298-45-3 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 2,9 and 8 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 298-45:
(5*2)+(4*9)+(3*8)+(2*4)+(1*5)=83
83 % 10 = 3
So 298-45-3 is a valid CAS Registry Number.
InChI:InChI=1/C19H19NO4/c1-20-6-5-11-8-14-19(24-9-23-14)17-15(11)12(20)7-10-3-4-13(22-2)18(21)16(10)17/h3-4,8,12,21H,5-7,9H2,1-2H3/t12-/m0/s1