33036-67-8 Usage
Description
ETHYL 2-OXAZOLECARBOXYLATE is an organic compound that serves as an intermediate in the synthesis of various chemical compounds, particularly in the production of 4-Bromooxazole-2-carboxylic Acid (B686295). This intermediate plays a crucial role in the development of heteroaryl-substituted 2-pyridinylmethylamine derivatives, which are selective 5-HT1A modulators.
Uses
Used in Pharmaceutical Industry:
ETHYL 2-OXAZOLECARBOXYLATE is used as a key intermediate in the synthesis of 4-Bromooxazole-2-carboxylic Acid (B686295) for the development of heteroaryl-substituted 2-pyridinylmethylamine derivatives. These derivatives are selective 5-HT1A modulators, which have potential applications in the treatment of various neurological and psychiatric disorders due to their ability to modulate the serotonin 1A receptor.
Check Digit Verification of cas no
The CAS Registry Mumber 33036-67-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,3,0,3 and 6 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 33036-67:
(7*3)+(6*3)+(5*0)+(4*3)+(3*6)+(2*6)+(1*7)=88
88 % 10 = 8
So 33036-67-8 is a valid CAS Registry Number.
InChI:InChI=1/C6H7NO3/c1-2-9-6(8)5-7-3-4-10-5/h3-4H,2H2,1H3
