36204-23-6 Usage
Description
Fibrinopeptide B is a peptide derived from fibrinogen (desAA-fibrin) through the action of thrombin. It plays a crucial role in the blood clotting process and is involved in various physiological and pathological processes in the body.
Uses
Used in Pharmaceutical Industry:
Fibrinopeptide B is used as a therapeutic agent for promoting wound healing and tissue repair. It stimulates the clotting process, which is essential for stopping bleeding and initiating the healing of injured tissues.
Used in Research and Diagnostics:
Fibrinopeptide B is used as a research tool for studying the mechanisms of blood clotting and related disorders. It can also be employed in the development of diagnostic tests to detect and monitor conditions associated with abnormal clotting, such as thrombosis and hemorrhage.
Used in Drug Development:
Fibrinopeptide B serves as a potential target for the development of new drugs aimed at modulating the clotting process. These drugs could be useful in treating conditions characterized by excessive clotting, such as deep vein thrombosis, or in situations where clotting is impaired, such as in patients with hemophilia.
Used in Tissue Engineering and Regenerative Medicine:
Fibrinopeptide B can be utilized in the development of biomaterials and scaffolds for tissue engineering and regenerative medicine applications. Its clotting-promoting properties make it a valuable component in designing materials that can support the growth and repair of various tissues in the body.
Check Digit Verification of cas no
The CAS Registry Mumber 36204-23-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,6,2,0 and 4 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 36204-23:
(7*3)+(6*6)+(5*2)+(4*0)+(3*4)+(2*2)+(1*3)=86
86 % 10 = 6
So 36204-23-6 is a valid CAS Registry Number.
InChI:InChI=1/C66H93N19O25/c1-31(2)53(85-49(91)29-73-55(99)35-16-19-47(89)75-35)64(108)83-42(26-46(68)88)61(105)82-43(27-52(96)97)62(106)81-41(25-45(67)87)60(104)78-37(18-21-51(94)95)57(101)77-36(17-20-50(92)93)56(100)72-28-48(90)76-39(23-33-11-6-4-7-12-33)58(102)80-40(24-34-13-8-5-9-14-34)59(103)84-44(30-86)63(107)74-32(3)54(98)79-38(65(109)110)15-10-22-71-66(69)70/h4-9,11-14,31-32,35-44,53,86H,10,15-30H2,1-3H3,(H2,67,87)(H2,68,88)(H,72,100)(H,73,99)(H,74,107)(H,75,89)(H,76,90)(H,77,101)(H,78,104)(H,79,98)(H,80,102)(H,81,106)(H,82,105)(H,83,108)(H,84,103)(H,85,91)(H,92,93)(H,94,95)(H,96,97)(H,109,110)(H4,69,70,71)/t32-,35-,36-,37-,38-,39-,40-,41-,42-,43-,44-,53-/m0/s1