3718-88-5 Usage
Uses
Used in Pharmaceutical Industry:
Benzenemethanamine,3-iodo-, hydrochloride (1:1) is used as a starting reagent for the synthesis of various adenosine derivatives. It plays a crucial role in the development of N6-(3-iodobenzyl)-2-substituted-adenosine derivatives, which have potential applications in the treatment of various diseases and conditions.
Benzenemethanamine,3-iodo-, hydrochloride (1:1) is also used as a starting reagent in the synthesis of 3′-C-methyl adenosine N6-substituted and N6/C-2 disubstituted derivatives. These derivatives have potential applications in the pharmaceutical industry, particularly in the development of new drugs with specific therapeutic properties.
Furthermore, Benzenemethanamine,3-iodo-, hydrochloride (1:1) is utilized in the synthesis of novel 2′-C-methyl analogues. These analogues may have unique properties and applications in the pharmaceutical industry, contributing to the development of innovative drugs and therapies.
Check Digit Verification of cas no
The CAS Registry Mumber 3718-88-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,7,1 and 8 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 3718-88:
(6*3)+(5*7)+(4*1)+(3*8)+(2*8)+(1*8)=105
105 % 10 = 5
So 3718-88-5 is a valid CAS Registry Number.
InChI:InChI=1/C7H8IN/c8-7-3-1-2-6(4-7)5-9/h1-4H,5,9H2/p+1
3718-88-5Relevant articles and documents
Preparation method of meto-Iodobenzylguanidine
-
Paragraph 0028; 0029, (2017/02/17)
The invention relates to a preparation method of I-MIBG (meto-Iodobenzylguanidine). The method comprises the following steps: heating meto-Iodobenzylguanidine sulfate, stannous mono-sulphate, a reducing agent, copper sulfate and NaI in a boiling water bath, standing after finishing the reaction, taking a supernatant liquid, and filtering the supernatant liquid with a microfiltration membrane. Sodium thiosulfate and/or sodium thiosulfate are/is taken as the reducing agent to prepare the meto-Iodobenzylguanidine sulfate, the prepared I-MIBG is high in radiochemical purity and good in stability, and the radiochemical purity of the prepared I-MIBG is still at a relatively high level after 48 hours.
