374063-99-7 Usage
Description
4-AMINO-1-PYRIDIN-3-YLBUTAN-1-ONE OXIME MONOHYDROCHLORIDE is a hydrochloride salt form of the oxime derivative of a pyridine compound, which is utilized in the pharmaceutical industry as a reagent for the synthesis of various pharmaceutical products. It possesses potential antioxidant and neuroprotective properties, making it a promising candidate for the development of drugs targeting neurological disorders. Additionally, it serves as an intermediate in the synthesis of other organic compounds, contributing to drug discovery and development.
Uses
Used in Pharmaceutical Industry:
4-AMINO-1-PYRIDIN-3-YLBUTAN-1-ONE OXIME MONOHYDROCHLORIDE is used as a reagent for the synthesis of various pharmaceutical products, playing a crucial role in the development of new medications.
Used in Drug Development for Neurological Disorders:
Leveraging its potential antioxidant and neuroprotective properties, 4-AMINO-1-PYRIDIN-3-YLBUTAN-1-ONE OXIME MONOHYDROCHLORIDE is utilized in the development of drugs aimed at treating neurological disorders, offering a promising avenue for therapeutic intervention.
Used as an Intermediate in Organic Synthesis:
4-AMINO-1-PYRIDIN-3-YLBUTAN-1-ONE OXIME MONOHYDROCHLORIDE is employed as an intermediate in the synthesis of other organic compounds, highlighting its versatility and value in the field of drug discovery and development.
Check Digit Verification of cas no
The CAS Registry Mumber 374063-99-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,7,4,0,6 and 3 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 374063-99:
(8*3)+(7*7)+(6*4)+(5*0)+(4*6)+(3*3)+(2*9)+(1*9)=157
157 % 10 = 7
So 374063-99-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H13N3O.ClH/c10-5-1-4-9(12-13)8-3-2-6-11-7-8;/h2-3,6-7,13H,1,4-5,10H2;1H/b12-9+;
