38154-43-7 Usage
General Description
Quinazoline, 4,7-dichloro-2-methyl- is a chemical compound that belongs to the quinazoline family. It is characterized by its molecular structure, which consists of a quinazoline ring with two chlorine atoms at positions 4 and 7, and a methyl group at position 2. Quinazoline, 4,7-dichloro-2-methyl- is commonly used in the pharmaceutical industry as a building block for the synthesis of various pharmaceuticals and agrochemicals. Its unique structure and chemical properties make it an important intermediate in the production of drugs such as anticancer agents and antihypertensive medications. Additionally, it has potential applications in the development of new chemical entities with therapeutic properties. Overall, quinazoline, 4,7-dichloro-2-methyl- is a valuable chemical compound with versatile utility in the field of drug discovery and development.
Check Digit Verification of cas no
The CAS Registry Mumber 38154-43-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,8,1,5 and 4 respectively; the second part has 2 digits, 4 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 38154-43:
(7*3)+(6*8)+(5*1)+(4*5)+(3*4)+(2*4)+(1*3)=117
117 % 10 = 7
So 38154-43-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H6Cl2N2/c1-5-12-8-4-6(10)2-3-7(8)9(11)13-5/h2-4H,1H3
