3913-18-6 Usage
Description
2-Chloro-4,6-dimethyl-quinoline, a quinoline derivative with the molecular formula C11H10ClN, is a chemical compound known for its diverse biological activities and applications in the pharmaceutical industry. Its unique structure and reactivity make it a promising candidate for the development of new drugs, particularly for its antimicrobial, antifungal, and antiparasitic properties, as well as its potential role in promoting antimalarial activities.
Uses
Used in Pharmaceutical Industry:
2-Chloro-4,6-dimethyl-quinoline is used as a key intermediate in the synthesis of various pharmaceutical compounds for its antimicrobial, antifungal, and antiparasitic properties. Its unique structure and reactivity contribute to the development of new drugs with improved efficacy and safety profiles.
Used in Antimicrobial Applications:
2-Chloro-4,6-dimethyl-quinoline is employed as an antimicrobial agent, targeting a wide range of bacteria and inhibiting their growth and proliferation. Its potential use in the development of new antibiotics can help address the growing issue of antibiotic resistance.
Used in Antifungal Applications:
2-CHLORO-4,6-DIMETHYL-QUINOLINE is used as an antifungal agent, effective against various fungal species, including Candida and Aspergillus. Its incorporation into antifungal drugs can provide an alternative treatment option for fungal infections, particularly in cases of drug resistance.
Used in Antiparasitic Applications:
2-Chloro-4,6-dimethyl-quinoline is utilized as an antiparasitic agent, showing activity against parasites such as Plasmodium, the causative agent of malaria. Its potential role in promoting antimalarial activities can contribute to the development of new therapies for malaria treatment and prevention.
Used in Medicinal Chemistry and Drug Design:
2-CHLORO-4,6-DIMETHYL-QUINOLINE's structure and reactivity make it a subject of interest in medicinal chemistry and drug design. Researchers can explore its potential in the development of new chemical entities with novel mechanisms of action, leading to the discovery of innovative therapeutic agents.
Used in the Development of New Materials and Chemical Processes:
2-Chloro-4,6-dimethyl-quinoline's unique properties also make it a valuable component in the development of new materials and chemical processes. Its potential applications in various industries, such as agriculture, textiles, and environmental management, can lead to the creation of more effective and sustainable solutions.
Check Digit Verification of cas no
The CAS Registry Mumber 3913-18-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,9,1 and 3 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 3913-18:
(6*3)+(5*9)+(4*1)+(3*3)+(2*1)+(1*8)=86
86 % 10 = 6
So 3913-18-6 is a valid CAS Registry Number.
InChI:InChI=1/C11H10ClN/c1-7-3-4-10-9(5-7)8(2)6-11(12)13-10/h3-6H,1-2H3
3913-18-6Relevant articles and documents
Compounds having anticonvulsion activity, preparing methods thereof and applications of the compounds
-
, (2017/10/05)
The invention provides 7-substituted-5-methyl-1,2,4-triazolo[4,3-a] quinoline and 7-substituted-5-ethoxy-[1,2,4]-triazolo[4,3-a] quinoline compounds having anticonvulsion activity, preparing methods thereof and applications of the compounds in the field of preparing anticonvulsion medicines.
Quinoline antifolate thymidylate synthase inhibitors: Variation of the C2- and C4-substituents
Warner,Barker,Jackman,Burrows,Roberts,Bishop,O'Connor,Hughes
, p. 2761 - 2768 (2007/10/02)
Modifications to the bicyclic ring system of the potent thymidylate synthase (TS) inhibitor N-[4-[N-[(2-amino-3,4-dihydro-4-oxo-6- quinazolinyl)methyl]-N-prop-2-ynylamino]benzoyl]-L-glutamic acid (1, CB3717) have led to the synthesis of a series of quinol
