421-09-0 Usage
Description
(Trifluoromethyl)mercuric bromide, with the chemical formula CF3HgBr, is a highly toxic compound that exists as a white to off-white crystalline powder. It is soluble in organic solvents but insoluble in water. (trifluoromethyl)mercuric bromide is primarily used in academic and research settings due to its extreme toxicity, which can cause severe damage to the central nervous system, kidneys, and liver. Additionally, it poses a significant risk to the environment due to its persistence and potential for bioaccumulation.
Uses
Used in Academic and Research Settings:
(Trifluoromethyl)mercuric bromide is used as a research chemical for various applications in academic and research settings. Its unique properties make it valuable for specific experiments and studies, despite its extreme toxicity.
Due to the hazardous nature of (trifluoromethyl)mercuric bromide, it is crucial to follow proper handling, storage, and disposal procedures to minimize the risk of exposure and environmental contamination. This includes using appropriate personal protective equipment, working in well-ventilated areas, and adhering to strict waste disposal guidelines.
Check Digit Verification of cas no
The CAS Registry Mumber 421-09-0 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 4,2 and 1 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 421-09:
(5*4)+(4*2)+(3*1)+(2*0)+(1*9)=40
40 % 10 = 0
So 421-09-0 is a valid CAS Registry Number.
InChI:InChI=1/CF3.BrH.Hg/c2-1(3)4;;/h;1H;/q;;+1/p-1/rCBrF3Hg/c2-6-1(3,4)5
