427-01-0 Usage
Description
(16R,19E)-19,20-Didehydro-16-[(10β,13β,21S)-23-deoxy-21,22-dihydro-11-oxa-12,24-secostrychinidin-10-yl]corynan-17-oic acid methyl ester is an indole alkaloid derived from the Strychnos genus of plants. It is characterized by two indole-derived polycyclic moieties connected by a cyclic ether linkage. This complex structure endows it with potential biological activities and applications in various fields.
Uses
Used in Pharmaceutical Industry:
(16R,19E)-19,20-Didehydro-16-[(10β,13β,21S)-23-deoxy-21,22-dihydro-11-oxa-12,24-secostrychinidin-10-yl]corynan-17-oic acid methyl ester is used as a bioactive compound for its potential therapeutic properties. (16R,19E)-19,20-Didehydro-16-[(10β,13β,21S)-23-deoxy-21,22-dihydro-11-oxa-12,24-secostrychinidin-10-yl]corynan-17-oic acid methyl ester's unique structure allows it to interact with various biological targets, making it a promising candidate for the development of new drugs to treat various diseases.
Used in Chemical Research:
In the field of chemical research, (16R,19E)-19,20-Didehydro-16-[(10β,13β,21S)-23-deoxy-21,22-dihydro-11-oxa-12,24-secostrychinidin-10-yl]corynan-17-oic acid methyl ester serves as a valuable compound for studying the structure-activity relationships of indole alkaloids. Its complex structure provides insights into the design and synthesis of novel bioactive molecules with improved pharmacological properties.
Used in Drug Delivery Systems:
Similar to gallotannin, (16R,19E)-19,20-Didehydro-16-[(10β,13β,21S)-23-deoxy-21,22-dihydro-11-oxa-12,24-secostrychinidin-10-yl]corynan-17-oic acid methyl ester can be employed in drug delivery systems to enhance its bioavailability and therapeutic outcomes. Researchers can develop novel carriers, such as organic and metallic nanoparticles, to improve the compound's delivery and efficacy against specific targets.
Check Digit Verification of cas no
The CAS Registry Mumber 427-01-0 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 4,2 and 7 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 427-01:
(5*4)+(4*2)+(3*7)+(2*0)+(1*1)=50
50 % 10 = 0
So 427-01-0 is a valid CAS Registry Number.
InChI:InChI=1/C40H48N4O3/c1-4-23-21-43-17-15-40-30-11-7-9-13-32(30)44-37(40)29(27(23)19-34(40)43)22-47-38(44)35(39(45)46-3)28-18-33-36-26(14-16-42(33)20-24(28)5-2)25-10-6-8-12-31(25)41-36/h5-13,23,27-29,33-35,37-38,41H,4,14-22H2,1-3H3/b24-5-/t23-,27+,28+,29+,33+,34+,35-,37+,38+,40-/m1/s1