431-13-0 Usage
General Description
Iodofluoroacetamide is a chemical compound that contains iodine, fluorine, carbon, nitrogen, and oxygen atoms. It is commonly used in organic synthesis and chemical reactions as a reagent to introduce the iodofluoroacetamide group into various compounds. IODOFLUOROACETAMIDE is known for its ability to selectively react with certain functional groups, making it a versatile tool in chemical research and production. It has applications in pharmaceuticals, agrochemicals, and materials science, and its unique properties make it a valuable component in the development of new compounds and materials. Additionally, the iodofluoroacetamide group is a key component of certain drug molecules, making this compound of interest in the pharmaceutical industry for its potential therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 431-13-0 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 4,3 and 1 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 431-13:
(5*4)+(4*3)+(3*1)+(2*1)+(1*3)=40
40 % 10 = 0
So 431-13-0 is a valid CAS Registry Number.
InChI:InChI=1/C2H3FINO/c3-1(4)2(5)6/h1H,(H2,5,6)
