4384-92-3 Usage
Description
7-amino-1-naphthol is a chemical compound with the molecular formula C10H9NO. It is a derivative of naphthalene and contains an amino group and a hydroxyl group. 7-amino-1-naphthol is known for its role as a precursor in the synthesis of various dyes and pigments, its utility as a reagent in organic chemistry, and its potential biological activities.
Uses
Used in Dye and Pigment Industry:
7-amino-1-naphthol is used as a precursor for the synthesis of various dyes and pigments, such as azo dyes and metal complex dyes. Its chemical structure allows for the creation of a wide range of colorants that are utilized in different applications.
Used in Organic Chemistry:
As a reagent, 7-amino-1-naphthol is used in organic chemistry reactions, particularly in the preparation of heterocyclic compounds. Its functional groups facilitate various synthetic pathways, making it a versatile component in the creation of complex organic molecules.
Used in Biological Research:
7-amino-1-naphthol has been studied for its potential biological activities, including its role as an antioxidant and its ability to inhibit enzymes. These properties are of interest in the development of new pharmaceuticals and therapeutic agents, as well as in understanding fundamental biological processes.
Check Digit Verification of cas no
The CAS Registry Mumber 4384-92-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,3,8 and 4 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 4384-92:
(6*4)+(5*3)+(4*8)+(3*4)+(2*9)+(1*2)=103
103 % 10 = 3
So 4384-92-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H9NO/c11-8-5-4-7-2-1-3-10(12)9(7)6-8/h1-6,12H,11H2