4440-39-5 Usage
Description
3,6-Dihydroxy-5-oxo-1,3,6-cycloheptatriene-1-carboxylic acid is a chemical compound derived from cyclohepta-1,3,5-triene, featuring a carboxy group at position 1, an oxo group at position 5, and hydroxy groups at positions 3 and 6. This unique structure endows it with specific chemical properties and potential applications across various fields.
Uses
Used in Pharmaceutical Industry:
3,6-Dihydroxy-5-oxo-1,3,6-cycloheptatriene-1-carboxylic acid is used as a pharmaceutical intermediate for the synthesis of various drug compounds. Its structural features allow it to serve as a building block in the development of new medications, particularly those targeting specific biological pathways or receptors.
Used in Chemical Research:
In the field of chemical research, 3,6-Dihydroxy-5-oxo-1,3,6-cycloheptatriene-1-carboxylic acid is utilized as a subject of study to explore its reactivity, stability, and potential interactions with other molecules. This research can lead to a better understanding of its properties and open up new avenues for its application.
Used in Material Science:
3,6-Dihydroxy-5-oxo-1,3,6-cycloheptatriene-1-carboxylic acid may also find use in material science, where its unique structure could contribute to the development of novel materials with specific properties. For instance, it could be incorporated into polymers or other composites to enhance their characteristics for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 4440-39-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,4,4 and 0 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 4440-39:
(6*4)+(5*4)+(4*4)+(3*0)+(2*3)+(1*9)=75
75 % 10 = 5
So 4440-39-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H6O5/c9-5-1-4(8(12)13)2-6(10)7(11)3-5/h1-3,10-11H,(H,12,13)