463-15-0 Usage
Description
(E)-7-Cyano-2-heptene-4,6-diynoic acid, with the molecular formula C9H6N2O2, is a chemical compound that belongs to the class of diynoic acids, characterized by the presence of two triple bonds. (E)-7-Cyano-2-heptene-4,6-diynoic acid is known for its unique structure, which includes a cyanide group and a conjugated system of triple bonds, endowing it with intriguing chemical properties and reactivity. It is a significant building block for the synthesis of various organic compounds, making it a valuable asset in chemical research and the pharmaceutical industry.
Uses
Used in Chemical Research and Synthesis:
(E)-7-Cyano-2-heptene-4,6-diynoic acid is utilized as a key intermediate in the synthesis of a wide range of organic compounds. Its unique structure and reactivity make it a versatile building block for creating complex molecules with potential applications in various fields.
Used in Pharmaceutical Industry:
(E)-7-Cyano-2-heptene-4,6-diynoic acid may have potential applications in the pharmaceutical industry due to its unique chemical properties and reactivity. Its cyanide group and conjugated triple bond system could be harnessed to develop novel therapeutic agents or improve the synthesis of existing drugs.
Used in Organic Synthesis:
In the field of organic synthesis, (E)-7-Cyano-2-heptene-4,6-diynoic acid serves as a valuable starting material for the preparation of various organic compounds. Its reactivity and structural features make it an attractive candidate for the development of new synthetic routes and methodologies.
Overall, (E)-7-Cyano-2-heptene-4,6-diynoic acid is a crucial chemical compound with a broad spectrum of potential applications in research and industry, particularly in the areas of chemical research, pharmaceutical development, and organic synthesis.
Check Digit Verification of cas no
The CAS Registry Mumber 463-15-0 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 4,6 and 3 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 463-15:
(5*4)+(4*6)+(3*3)+(2*1)+(1*5)=60
60 % 10 = 0
So 463-15-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H3NO2/c9-7-5-3-1-2-4-6-8(10)11/h4,6H,(H,10,11)/b6-4+