466-57-9 Usage
Description
(17R,19E)-19,20-Didehydroajmalan-17-ol 3,4,5-trimethoxybenzoate is an alkaloid derived from Rauwolfia vomitora, a plant source. It forms colorless crystals when dissolved in methanol (MeOH) and exhibits a specific optical rotation of [α]D 173.4° ± 1° (c 1.0, CHCl3). The hydrochloride salt of this compound has a melting point of 223°C (dec.). Upon acid hydrolysis, it yields tetraphyllicine and gallic acid trimethyl ether.
Uses
1. Used in Pharmaceutical Industry:
(17R,19E)-19,20-Didehydroajmalan-17-ol 3,4,5-trimethoxybenzoate is used as a pharmaceutical compound for its potential therapeutic applications. The alkaloid's unique structure and properties make it a candidate for further research and development in the field of medicine.
2. Used in Chemical Research:
(17R,19E)-19,20-Didehydroajmalan-17-ol 3,4,5-trimethoxybenzoate is also used as a subject of study in chemical research, particularly in the investigation of alkaloids, their properties, and potential applications in various fields.
3. Used in Plant Source Studies:
As an alkaloid derived from Rauwolfia vomitora, (17R,19E)-19,20-Didehydroajmalan-17-ol 3,4,5-trimethoxybenzoate contributes to the understanding of the plant's chemical constituents and their potential uses in various industries, including pharmaceuticals and agriculture.
References
Haack, Popelak, Springler., Naturwiss., 42,627 (1955)
Poisson, Goutarel, Janot., Compt. rend., 241, 1840 (1955)
Bartlett et al., J. Amer. Chem. Soc., 84,622 (1962)
Check Digit Verification of cas no
The CAS Registry Mumber 466-57-9 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 4,6 and 6 respectively; the second part has 2 digits, 5 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 466-57:
(5*4)+(4*6)+(3*6)+(2*5)+(1*7)=79
79 % 10 = 9
So 466-57-9 is a valid CAS Registry Number.
InChI:InChI=1/C30H34N2O5/c1-6-16-15-32-21-13-18(16)25-22(32)14-30(19-9-7-8-10-20(19)31(2)27(21)30)28(25)37-29(33)17-11-23(34-3)26(36-5)24(12-17)35-4/h6-12,18,21-22,25,27-28H,13-15H2,1-5H3/b16-6-/t18-,21-,22-,25+,27?,28?,30+/m0/s1