46895-13-0 Usage
General Description
4-Methyl 6-Hydroxy 7-Acetoxy Coumarin is a chemical compound that falls under the class of organic compounds known as coumarins and derivatives. Coumarins are polycyclic aromatic compounds containing a 1-benzopyran moiety with a ketone group at the C2 carbon atom of the benzopyran. 4-Methyl 6-Hydroxy 7-Acetoxy Coumarin is a relatively neutral molecule and possibly soluble in water, making it potentially suitable for various chemical and pharmaceutical applications. However, specific properties such as its biological activities, safety and toxicity are yet to be thoroughly studied.
Check Digit Verification of cas no
The CAS Registry Mumber 46895-13-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,6,8,9 and 5 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 46895-13:
(7*4)+(6*6)+(5*8)+(4*9)+(3*5)+(2*1)+(1*3)=160
160 % 10 = 0
So 46895-13-0 is a valid CAS Registry Number.
InChI:InChI=1/C12H10O6/c1-6-2-12(16)18-9-4-10(17-5-11(14)15)8(13)3-7(6)9/h2-4,13H,5H2,1H3,(H,14,15)