47818-40-6 Usage
Description
6-(9-Carboxy-1-nonenyl)-4,5-dihexylcyclohex-2-ene-1-octanoic acid is a complex chemical compound that belongs to the class of fatty acids. It features a unique structure with carboxyl and nonenyl groups, along with multiple hexyl and octanoic groups. 6-(9-Carboxy-1-nonenyl)-4,5-dihexylcyclohex-2-ene-1-octanoic acid is likely derived from natural sources and may have potential applications across various industries, including pharmaceuticals, cosmetics, and as food additives. Further research and testing are required to determine its specific properties and uses.
Uses
Used in Pharmaceutical Industry:
6-(9-Carboxy-1-nonenyl)-4,5-dihexylcyclohex-2-ene-1-octanoic acid is used as a pharmaceutical compound for its potential therapeutic properties. Its unique molecular structure may contribute to the development of new drugs or treatments, particularly in areas that require novel chemical entities.
Used in Cosmetic Industry:
In the cosmetics industry, 6-(9-Carboxy-1-nonenyl)-4,5-dihexylcyclohex-2-ene-1-octanoic acid is used as an ingredient for its potential benefits to skin health and appearance. Its complex structure may offer moisturizing, anti-aging, or protective properties when incorporated into cosmetic formulations.
Used in Food Additives Industry:
6-(9-Carboxy-1-nonenyl)-4,5-dihexylcyclohex-2-ene-1-octanoic acid is used as a food additive for its potential to enhance the taste, texture, or shelf life of various food products. Its unique properties may contribute to the development of innovative food products or improve existing ones.
Check Digit Verification of cas no
The CAS Registry Mumber 47818-40-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,7,8,1 and 8 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 47818-40:
(7*4)+(6*7)+(5*8)+(4*1)+(3*8)+(2*4)+(1*0)=146
146 % 10 = 6
So 47818-40-6 is a valid CAS Registry Number.
InChI:InChI=1/C36H64O4/c1-3-5-7-17-23-31-29-30-32(24-18-13-12-16-22-28-36(39)40)34(33(31)25-19-8-6-4-2)26-20-14-10-9-11-15-21-27-35(37)38/h20,26,29-34H,3-19,21-25,27-28H2,1-2H3,(H,37,38)(H,39,40)/b26-20+