484-08-2 Usage
Description
KOKUSAGININE is a naturally occurring compound with various biological activities and potential applications in different industries. It is known for its unique chemical structure and properties that make it a valuable compound for research and development.
Uses
Used in Pharmaceutical Industry:
KOKUSAGININE is used as an active pharmaceutical ingredient for the development of drugs targeting various health conditions. Its specific application reason is due to its biological activities and potential therapeutic effects.
Used in Cosmetic Industry:
KOKUSAGININE is used as an ingredient in the cosmetic industry for its potential benefits in skincare and beauty products. The application reason is its ability to provide certain advantages, such as anti-aging or skin brightening effects.
Used in Research and Development:
KOKUSAGININE is used as a research compound for studying its chemical properties, biological activities, and potential applications in various fields. The application reason is to gain a deeper understanding of its characteristics and explore its potential uses.
Used in Drug Preparation for Vitiligo Treatment:
KOKUSAGININE is used in the preparation of drugs for treating vitiligo, as mentioned in the provided materials. The application reason is its potential role in addressing the condition, possibly through its interaction with other compounds like Alkaloids and Vanillin, and its source from Eucalyptus grandis.
Check Digit Verification of cas no
The CAS Registry Mumber 484-08-2 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 4,8 and 4 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 484-08:
(5*4)+(4*8)+(3*4)+(2*0)+(1*8)=72
72 % 10 = 2
So 484-08-2 is a valid CAS Registry Number.
InChI:InChI=1/C14H13NO4/c1-16-11-6-9-10(7-12(11)17-2)15-14-8(4-5-19-14)13(9)18-3/h4-7H,1-3H3
