5090-36-8 Usage
Description
3-(2-aminoethyl)-1H-indole-5,6-diol is a chemical compound with the molecular formula C10H12N2O2. It is a derivative of indole, a heterocyclic aromatic organic compound. This chemical is a diol, meaning it contains two hydroxyl groups. The aminoethyl group at the third position of the indole ring indicates the presence of an amine functional group, making it a biologically active compound. 3-(2-aminoethyl)-1H-indole-5,6-diol has potential pharmacological properties and can be used in the synthesis of various pharmaceutical drugs and organic compounds.
Uses
Used in Pharmaceutical Industry:
3-(2-aminoethyl)-1H-indole-5,6-diol is used as a building block for the synthesis of various pharmaceutical drugs and organic compounds. Its unique structure and functional groups make it a valuable component in the development of new medications and therapeutic agents.
Used in Organic Chemistry:
3-(2-aminoethyl)-1H-indole-5,6-diol is used as a reagent in organic chemistry for the synthesis of various organic compounds. Its amine functional group allows for a wide range of chemical reactions, making it a versatile compound for use in the synthesis of other molecules.
Used in Research and Development:
3-(2-aminoethyl)-1H-indole-5,6-diol is used as a research compound in the study of biological processes and the development of new drugs. Its potential pharmacological properties make it an interesting target for research in various fields, including medicinal chemistry, pharmacology, and biochemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 5090-36-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,0,9 and 0 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 5090-36:
(6*5)+(5*0)+(4*9)+(3*0)+(2*3)+(1*6)=78
78 % 10 = 8
So 5090-36-8 is a valid CAS Registry Number.
InChI:InChI=1/C10H12N2O2/c11-2-1-6-5-12-8-4-10(14)9(13)3-7(6)8/h3-5,12-14H,1-2,11H2
