52034-92-1 Usage
Description
Dicyclohexylacetic acid is an organic compound characterized by its solid state and a molecular structure featuring two cyclohexyl rings attached to an acetic acid backbone. This unique arrangement of atoms endows it with specific chemical properties that make it suitable for various applications across different industries.
Uses
Used in Pharmaceutical Industry:
Dicyclohexylacetic acid is used as a pharmaceutical intermediate, playing a crucial role in the synthesis of various drugs and medications. Its chemical properties allow it to serve as a building block for the development of new pharmaceutical compounds.
Used in the Synthesis of Benzoylthiophenes:
Dicyclohexylacetic acid is utilized in the synthesis of benzoylthiophenes, which are allosteric enhancers (AE) of agonist activity at the A1 adenosine receptor. This application highlights its importance in the development of drugs targeting the adenosine receptor, which has therapeutic potential in various conditions, including neurological disorders and cardiovascular diseases.
Used in the Synthesis of 2,2-dicyclohexyl-1-(4′-methyl)-phenylethanone:
This organic compound is synthesized using dicyclohexylacetic acid, which contributes to its molecular structure and properties. The resulting compound may have potential applications in various fields, such as materials science or pharmaceuticals.
Dicyclohexylacetic acid is also employed in the synthesis of catena-poly [[trimethyltin (IV)]--2, 2-dicyclohexylacetato-2O: O′], a complex organic compound with potential applications in materials science, particularly in the development of new polymers and coordination compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 52034-92-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,2,0,3 and 4 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 52034-92:
(7*5)+(6*2)+(5*0)+(4*3)+(3*4)+(2*9)+(1*2)=91
91 % 10 = 1
So 52034-92-1 is a valid CAS Registry Number.
InChI:InChI=1/C14H24O2/c15-14(16)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h11-13H,1-10H2,(H,15,16)
52034-92-1Relevant articles and documents
HETEROCUMULENES IN ACYLATION REACTIONS II. REACTIVITY OF ALKYL-SUBSTITUTED KETENES IN SPONTANEOUS HYDROLYSIS REACTIONS
Lyashchuk, S. N.,Skrypnik, Yu. G.
, p. 10 - 17 (2007/10/02)
The structures and electronic states of six ketenes were investigated by the semiempirical MNDO, MINDO/3, and AM1 quantum-chemical methods.The kinetics of the spontaneous hydrolysis of mono- and dialkylsubstituted ketenes in water and water-acetonitrile mixtures at 20 deg C were studied.The induction and steric effects of the substituents on the process rate were evaluated quantitatively in terms of a ρ? analysis.An increase in the number, length, and branching of the hydrocarbon substituents at the terminal carbon atom of the ketenes leads to a large decrease in the hydrolysis rate.The results of the calculations were compared with experimental data.Possible alternatives for the mechanism of the process are discussed.
