523-42-2 Usage
Description
CYANINE, also known as Quinoline Blue (CAS# 523-42-2), is an organic dye with a variety of applications across different industries. It is characterized by its vibrant blue color and unique properties that make it suitable for various uses.
Uses
Used in Display Technology Industry:
CYANINE is used as a photoresist for the preparation of liquid crystal displays. Its ability to form photoresists allows for the creation of high-quality displays with improved performance and durability.
Used in Pharmaceutical Industry:
CYANINE is used as a pharmaceutical candidate for various applications, such as imaging agents and drug delivery systems. Its unique properties enable it to interact with biopolymers and macromolecules, making it a promising candidate for the development of new drugs and therapies.
Used in Chemical Industry:
CYANINE is used as a reagent and indicator in various chemical reactions and processes. Its distinct color and properties make it an ideal choice for detecting and monitoring specific reactions, contributing to the efficiency and accuracy of chemical processes.
Used in Research and Development:
CYANINE is used as a research tool in the field of life sciences and materials science. Its ability to interact with various biological and synthetic materials makes it a valuable asset for studying the properties and behavior of different substances, leading to advancements in scientific knowledge and technology.
Check Digit Verification of cas no
The CAS Registry Mumber 523-42-2 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 5,2 and 3 respectively; the second part has 2 digits, 4 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 523-42:
(5*5)+(4*2)+(3*3)+(2*4)+(1*2)=52
52 % 10 = 2
So 523-42-2 is a valid CAS Registry Number.
InChI:InChI=1/C29H35N2.HI/c1-22(2)13-17-30-19-15-24(26-9-5-7-11-28(26)30)21-25-16-20-31(18-14-23(3)4)29-12-8-6-10-27(25)29;/h5-12,15-16,19-23H,13-14,17-18H2,1-4H3;1H/q+1;/p-1