5398-75-4 Usage
Molecular structure
1-methyl-7-propan-2-yl-phenanthrene-9,10-dione has a complex molecular structure with a phenanthrene backbone, a methyl group attached to the 1st carbon, and a propan-2-yl group attached to the 7th carbon.
Functional groups
The compound contains a ketone functional group at the 9th and 10th positions, which may contribute to its unique chemical properties and reactivity.
Potential applications
Due to its unique structure and properties, 1-methyl-7-propan-2-yl-phenanthrene-9,10-dione may have potential applications in organic synthesis or medicinal chemistry.
Further research
More research is needed to fully understand the potential uses and effects of this chemical compound, as its properties and applications are not yet well-established.
Check Digit Verification of cas no
The CAS Registry Mumber 5398-75-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,3,9 and 8 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 5398-75:
(6*5)+(5*3)+(4*9)+(3*8)+(2*7)+(1*5)=124
124 % 10 = 4
So 5398-75-4 is a valid CAS Registry Number.
InChI:InChI=1/C18H16O2/c1-10(2)12-7-8-13-14-6-4-5-11(3)16(14)18(20)17(19)15(13)9-12/h4-10H,1-3H3
