54104-82-4 Usage
Description
Pyrrolidine, 1-(4-Methylphenyl)-, also known as 4-methylphenylpyrrolidine, is a chemical compound with the molecular formula C11H15N. It is a derivative of pyrrolidine, featuring a five-membered heterocyclic ring containing one nitrogen atom. This colorless liquid with a faint odor is insoluble in water but soluble in organic solvents. Widely used in the pharmaceutical and research industries, it serves as a building block for the synthesis of various drugs and organic compounds, and holds potential in medicinal chemistry and drug development.
Uses
Used in Pharmaceutical Industry:
Pyrrolidine, 1-(4-Methylphenyl)is used as a key intermediate in the synthesis of various pharmaceuticals for its ability to form complex molecular structures that can target specific biological pathways.
Used in Research Industry:
In the research field, Pyrrolidine, 1-(4-Methylphenyl)is utilized as a building block for the development of new organic compounds, contributing to the advancement of chemical libraries and the discovery of novel substances with potential applications.
Used in Medicinal Chemistry:
Pyrrolidine, 1-(4-Methylphenyl)is employed as a structural component in medicinal chemistry to design and develop new drugs, taking advantage of its unique properties to create molecules with specific therapeutic effects.
Used in Drug Development:
Pyrrolidine, 1-(4-Methylphenyl)plays a role in drug development as a precursor in the creation of new pharmaceutical entities, potentially leading to the discovery of innovative treatments and therapies for various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 54104-82-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,4,1,0 and 4 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 54104-82:
(7*5)+(6*4)+(5*1)+(4*0)+(3*4)+(2*8)+(1*2)=94
94 % 10 = 4
So 54104-82-4 is a valid CAS Registry Number.
InChI:InChI=1/C11H15N/c1-10-4-6-11(7-5-10)12-8-2-3-9-12/h4-7H,2-3,8-9H2,1H3
