54971-26-5 Usage
Description
2-BROMOHEXANOYL BROMIDE, with the molecular formula C6H10Br2O, is a colorless to light yellow liquid that exhibits a pungent odor. This reactive chemical compound is widely utilized in organic synthesis and chemical reactions, particularly in the production of pharmaceuticals, agrochemicals, and other organic compounds. Its ability to form esters, amides, and other organic derivatives makes it a valuable asset in the field of organic chemistry. However, due to its corrosive and toxic nature, it is crucial to handle 2-BROMOHEXANOYL BROMIDE with caution and proper safety measures.
Uses
Used in Pharmaceutical Industry:
2-BROMOHEXANOYL BROMIDE is used as a reagent for the synthesis of various pharmaceutical compounds. Its capacity to form esters and amides makes it instrumental in creating new drug molecules and enhancing the properties of existing ones.
Used in Agrochemical Industry:
In the agrochemical sector, 2-BROMOHEXANOYL BROMIDE is employed as a reagent for the production of pesticides and other agrochemicals. Its versatility in forming organic derivatives contributes to the development of effective and innovative products for agricultural applications.
Used in Organic Chemistry Research:
2-BROMOHEXANOYL BROMIDE is used as a research tool in organic chemistry to explore new reactions and mechanisms. Its reactivity allows chemists to study and understand the formation of various organic compounds and their properties, furthering the knowledge in the field of organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 54971-26-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,4,9,7 and 1 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 54971-26:
(7*5)+(6*4)+(5*9)+(4*7)+(3*1)+(2*2)+(1*6)=145
145 % 10 = 5
So 54971-26-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H10Br2O/c1-2-3-4-5(7)6(8)9/h5H,2-4H2,1H3
