55610-01-0 Usage
Description
5H-Benzo[g]-1,3-benzodioxolo[6,5,4-de]quinoline-5,6(7H)-dione, 7-methylis a complex organic compound derived from the callus tissue of Stephania cepharantha. It belongs to the aporphine class and is characterized by its bright orange fluorescence and unique molecular structure, which includes a methylenedioxy group and a methylimino group. 5H-Benzo[g]-1,3-benzodioxolo[6,5,4-de]quinoline-5,6(7H)-dione, 7-methy lforms orange needles that melt above 350°C and exhibits distinct absorption maxima in its ultraviolet spectrum.
Uses
Used in Pharmaceutical Industry:
5H-Benzo[g]-1,3-benzodioxolo[6,5,4-de]quinoline-5,6(7H)-dione, 7-methylis used as a potential therapeutic agent for various medical applications due to its unique chemical properties and biological activities. Its bright orange fluorescence and distinct absorption maxima in the ultraviolet spectrum make it a promising candidate for the development of new drugs and therapies.
Used in Chemical Research:
5H-Benzo[g]-1,3-benzodioxolo[6,5,4-de]quinoline-5,6(7H)-dione, 7-methy lis also used as a research tool in the field of organic chemistry, particularly in the study of aporphine alkaloids and their derivatives. Its unique molecular structure and properties can provide valuable insights into the synthesis, reactivity, and potential applications of related compounds.
Used in Material Science:
The bright orange fluorescence and thermal stability of 5H-Benzo[g]-1,3-benzodioxolo[6,5,4-de]quinoline-5,6(7H)-dione, 7-methylmake it a candidate for use in the development of new materials with specific optical and thermal properties. These materials could have potential applications in various industries, such as electronics, sensors, and advanced coatings.
Check Digit Verification of cas no
The CAS Registry Mumber 55610-01-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,5,6,1 and 0 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 55610-01:
(7*5)+(6*5)+(5*6)+(4*1)+(3*0)+(2*0)+(1*1)=100
100 % 10 = 0
So 55610-01-0 is a valid CAS Registry Number.
InChI:InChI=1/C18H11NO4/c1-19-12-6-9-4-2-3-5-10(9)15-14(12)11(16(20)18(19)21)7-13-17(15)23-8-22-13/h2-7H,8H2,1H3
55610-01-0Relevant articles and documents
Synthesis and biological evaluation of cepharadiones A and B and related dioxoaporphines
Elban, Mark A.,Chapuis, Jean C.,Li, Mei,Hecht, Sidney M.
, p. 6119 - 6125 (2007)
Described herein is the first total synthesis and structural confirmation of cepharadione A, a naturally occurring DNA damaging agent. Also reported is the synthesis of cepharadione B, a closely related natural product, as well as the biological evaluatio