55934-00-4 Usage
Description
Pyridine,3,4-dichlorois a dichlorinated pyridine compound, characterized by the presence of two chlorine atoms at the 3rd and 4th positions on the pyridine ring. It serves as a versatile building block in the synthesis of various 3,4-substituted pyridine compounds, which have diverse applications in different industries.
Uses
Used in Pharmaceutical Industry:
Pyridine,3,4-dichlorois used as a key intermediate in the synthesis of pharmaceutical compounds. Its unique structure allows for the development of new drugs with potential therapeutic applications, such as antibiotics, antivirals, and anticancer agents.
Used in Agrochemical Industry:
In the agrochemical industry, Pyridine,3,4-dichlorois utilized as a precursor for the production of agrochemicals, including herbicides, insecticides, and fungicides. Its ability to form various 3,4-substituted pyridine derivatives enables the creation of effective and targeted pest control solutions.
Used in Chemical Research:
Pyridine,3,4-dichlorois also employed as a research compound in the field of organic chemistry. Its reactivity and structural properties make it an ideal candidate for studying reaction mechanisms, exploring new synthetic routes, and developing novel chemical methodologies.
Used in Material Science:
In the realm of material science, Pyridine,3,4-dichlorois used as a building block for the development of advanced materials, such as conductive polymers, sensors, and catalysts. Its ability to form stable complexes with various metal ions and its electron-withdrawing nature contribute to the creation of innovative materials with unique properties and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 55934-00-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,5,9,3 and 4 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 55934-00:
(7*5)+(6*5)+(5*9)+(4*3)+(3*4)+(2*0)+(1*0)=134
134 % 10 = 4
So 55934-00-4 is a valid CAS Registry Number.
InChI:InChI=1/C5H3Cl2N/c6-4-1-2-8-3-5(4)7/h1-3H
55934-00-4Relevant articles and documents
Site-Selectivity in the Reaction of 3-Substituted Pyridine 1-Oxides with Phosphoryl Chloride
Yamanaka, Hiroshi,Araki, Tomio,Sakamoto, Takao
, p. 2244 - 2247 (2007/10/02)
Site-selectivity in the reaction of 3-substituted pyridine 1-oxide with phosphoryl chloride was investigated.When a strongly electron-withdrawing group (e.g.CN, CONRR', COOR, or NO2) was substituted at the 3-position, the reaction of 3-substituted pyridine 1-oxides with phosphoryl chloride yielded 3-substituted 2-chloropyridines as the main products.Keywords- site-selectivity; 3-substituted pyridine 1-oxide; phosphoryl chloride; 3-substituted 2-chloropyridine; chlorination
