61278-81-7 Usage
Description
1-(Diethoxymethyl)imidazole is an orthoamide protected imidazole, a 1-substituted imidazole derivative. It is characterized by its unique chemical structure, which allows for selective reactions at the 2 position. 1-(DIETHOXYMETHYL)IMIDAZOLE is known for its potential in the synthesis of various hydroxyand amino-functionalized imidazoles.
Uses
Used in Pharmaceutical and Chemical Industries:
1-(Diethoxymethyl)imidazole is used as a key intermediate for the synthesis of various hydroxyand amino-functionalized imidazoles. Its application is primarily due to its ability to undergo isoprene-mediated lithiation, leading to the formation of a 2-lithio intermediate. This intermediate can then react with different electrophiles, resulting in the production of 2-functionalized imidazoles, which have potential applications in the development of pharmaceuticals and other chemical compounds.
Used in Organic Chemistry Research:
In the field of organic chemistry, 1-(Diethoxymethyl)imidazole serves as a valuable compound for research purposes. Its unique reactivity and the ability to form selective 2-lithio intermediates make it an attractive candidate for exploring new synthetic pathways and developing novel chemical reactions. This can lead to the discovery of new compounds with potential applications in various industries, including pharmaceuticals, materials science, and agrochemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 61278-81-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,1,2,7 and 8 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 61278-81:
(7*6)+(6*1)+(5*2)+(4*7)+(3*8)+(2*8)+(1*1)=127
127 % 10 = 7
So 61278-81-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H14N2O2/c1-3-11-8(12-4-2)10-6-5-9-7-10/h5-8H,3-4H2,1-2H3
61278-81-7Relevant articles and documents
[(C3H4N2)2Au] Cl - A bis protic gold(i)-NHC
Kunz, Peter C.,Wetzel, Corinna,Koegel, Susanne,Kassack, Matthias U.,Spingler, Bernhard
, p. 35 - 37 (2011)
The gold(i) bis-NHC (NHC = imidazol-2-ylidene) parent compound was synthesised in high yield by a three step reaction starting from imidazole. The compound is highly water soluble and stable in concentrated hydrochloric acid.
1-SUBSTITUTED 4-NITROIMIDAZOLE COMPOUND AND PROCESS FOR PRODUCING THE SAME
-
Page/Page column 51, (2010/02/12)
The present invention relates to a 1-substituted-4-nitroimidazole compound represented by the general formula (1) or a salt thereof, (wherein R is a hydrogen atom, a lower alkoxy group-substituted lower alkyl group, a phenyl-lower alkoxy group-substituted lower alkyl group, a cyano-substituted lower alkyl group, a phenyl-lower alkyl group which may have lower alkoxy groups as the substituents in the phenyl ring or a group of the formula -CH2RA; X is a halogen atom or a group of the formula -S(O)n-R1) and method for preparing the same. The compound of the formula (1) is a useful compound as an intermediate for synthesis of various pharmaceutical and agricultural chemicals, particularly, as intermediates for antitubercular agents.
A "traceless" Staudinger ligation for the chemoselective synthesis of amide bonds
Saxon, Eliana,Armstrong, Joshua I.,Bertozzi, Carolyn R.
, p. 2141 - 2143 (2007/10/03)
equation presented Here we report a novel modification of our previously reported "Staudinger ligation" that generates an amide bond from an azide and a specifically functionalized phosphine. This method for the selective formation of an amide bond, which