6220-47-9 Usage
Description
2(1H)-Pyrimidinone, 4-(methylamino)(9CI), also known as cytosine N4-methyl, is a pyrimidone derivative that features a cytosine molecule with an N4-methyl substituent. This off-white solid exhibits unique chemical properties, making it a versatile compound for various applications.
Uses
Used in Pharmaceutical Industry:
2(1H)-Pyrimidinone, 4-(methylamino)(9CI) is used as an active pharmaceutical ingredient for the development of drugs targeting various diseases. Its unique chemical structure allows it to interact with biological systems, making it a promising candidate for drug discovery and therapeutic applications.
Used in Chemical Research:
In the field of chemical research, 2(1H)-Pyrimidinone, 4-(methylamino)(9CI) serves as a valuable compound for studying the properties and behavior of pyrimidone derivatives. Its unique structure provides insights into the design and synthesis of new molecules with potential applications in various industries.
Used in Biochemical Applications:
2(1H)-Pyrimidinone, 4-(methylamino)(9CI) is utilized in biochemical applications for its ability to interact with biological molecules. Its unique structure allows it to be used in the development of diagnostic tools, therapeutic agents, and other biocompatible materials.
Check Digit Verification of cas no
The CAS Registry Mumber 6220-47-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,2,2 and 0 respectively; the second part has 2 digits, 4 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 6220-47:
(6*6)+(5*2)+(4*2)+(3*0)+(2*4)+(1*7)=69
69 % 10 = 9
So 6220-47-9 is a valid CAS Registry Number.
InChI:InChI=1/C5H7N3O/c1-6-4-2-3-7-5(9)8-4/h2-3H,1H3,(H2,6,7,8,9)
