6301-46-8 Usage
General Description
5,5-Bis(propan-2-ylsulfanyl)pentane-1,2,3-triol, also known as Tiron, is a chemical compound with the molecular formula C10H22O3S2. It is a derivative of the sugar alcohol, glycerol, and contains two thiol groups. Tiron is a chelating agent, meaning it has the ability to bind to metal ions. It is commonly used in analytical chemistry to stabilize metal ions in solution and prevent their precipitation. Tiron has also been investigated for potential therapeutic applications, including antioxidant and anti-inflammatory properties. Its unique structure and metal-chelating properties make Tiron a valuable compound in various scientific and industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 6301-46-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,0 and 1 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 6301-46:
(6*6)+(5*3)+(4*0)+(3*1)+(2*4)+(1*6)=68
68 % 10 = 8
So 6301-46-8 is a valid CAS Registry Number.
InChI:InChI=1/C11H24O3S2/c1-7(2)15-11(16-8(3)4)5-9(13)10(14)6-12/h7-14H,5-6H2,1-4H3
