6600-90-4 Usage
Description
(6Z)-4,5-bis(hydroxymethyl)-2-methyl-6-(phenylhydrazinylidene)pyridin-3-one is a chemical compound with potential pharmaceutical properties, featuring a pyridin-3-one ring, a phenylhydrazinylidene substituent, and two hydroxymethyl groups. Its unique structure and functional groups make it a subject of interest for researchers in medicinal chemistry.
Uses
Used in Pharmaceutical Industry:
(6Z)-4,5-bis(hydroxymethyl)-2-methyl-6-(phenylhydrazinylidene)pyridin-3-one is used as a potential candidate for the development of new drugs or treatments due to its unique structure and functional groups, which may offer novel therapeutic effects and applications in medicine.
Further studies and research are needed to fully understand the potential uses and effects of this compound in various medical applications.
Check Digit Verification of cas no
The CAS Registry Mumber 6600-90-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,6,0 and 0 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 6600-90:
(6*6)+(5*6)+(4*0)+(3*0)+(2*9)+(1*0)=84
84 % 10 = 4
So 6600-90-4 is a valid CAS Registry Number.
InChI:InChI=1/C14H15N3O3/c1-9-13(20)11(7-18)12(8-19)14(15-9)17-16-10-5-3-2-4-6-10/h2-6,16,18-19H,7-8H2,1H3/b17-14-