6622-81-7 Usage
Description
[(Z)-[(E)-4-thiophen-2-ylbut-3-en-2-ylidene]thiocarbamoyl]thiourea is a complex chemical compound characterized by its unique structure, which includes a thiophene ring, a butenylidene group, a thiocarbamoyl group, and a thiourea group. [(Z)-[(E)-4-thiophen-2-ylbut-3-en-2-ylidene]thiocarbamoyl]thiourea exhibits both Z and E stereochemistry, reflecting the configuration of its double bonds. The presence of sulfur atoms and the potential reactivity of the thiocarbamoyl and thiourea functional groups make this compound an interesting candidate for various applications.
Uses
Used in Organic Synthesis:
[(Z)-[(E)-4-thiophen-2-ylbut-3-en-2-ylidene]thiocarbamoyl]thiourea is used as a synthetic building block for the creation of novel organic compounds. Its unique structure and potential reactivity with other molecules make it a valuable component in the development of new chemical entities.
Used in Material Science:
In the field of material science, [(Z)-[(E)-4-thiophen-2-ylbut-3-en-2-ylidene]thiocarbamoyl]thiourea is used as a precursor for the development of new materials with specific properties. [(Z)-[(E)-4-thiophen-2-ylbut-3-en-2-ylidene]thiocarbamoyl]thiourea's structural features and reactivity may contribute to the creation of advanced materials with applications in various industries, such as electronics, pharmaceuticals, and energy.
Used in Pharmaceutical Research:
[(Z)-[(E)-4-thiophen-2-ylbut-3-en-2-ylidene]thiocarbamoyl]thiourea is used as a starting material in the design and synthesis of new pharmaceutical compounds. Its unique structure and functional groups may provide opportunities for the development of novel drugs with improved efficacy and selectivity.
Used in Chemical Research:
In the field of chemical research, [(Z)-[(E)-4-thiophen-2-ylbut-3-en-2-ylidene]thiocarbamoyl]thiourea serves as a model compound for studying the properties and reactivity of complex organic molecules. [(Z)-[(E)-4-thiophen-2-ylbut-3-en-2-ylidene]thiocarbamoyl]thiourea can be used to gain insights into the behavior of similar molecules and to develop new synthetic strategies and methodologies.
Used in Environmental Applications:
[(Z)-[(E)-4-thiophen-2-ylbut-3-en-2-ylidene]thiocarbamoyl]thiourea may also find applications in environmental science, where it could be used to develop new methods for pollution control, waste management, or the remediation of contaminated sites. Its unique structure and reactivity could be harnessed to address specific environmental challenges.
Check Digit Verification of cas no
The CAS Registry Mumber 6622-81-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,6,2 and 2 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 6622-81:
(6*6)+(5*6)+(4*2)+(3*2)+(2*8)+(1*1)=97
97 % 10 = 7
So 6622-81-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H11N3S3/c1-7(12-10(15)13-9(11)14)4-5-8-3-2-6-16-8/h2-6H,1H3,(H3,11,13,14,15)/b5-4+,12-7+
