6624-95-9 Usage
Description
2-furylmethyl N-(4-phenylphenyl)carbamate is an organic compound with the molecular formula C17H15NO3. It is a carbamate derivative that features a furylmethyl group and a substituted phenyl group, making it a versatile intermediate in organic chemistry and pharmaceuticals.
Uses
Used in Organic Chemistry:
2-furylmethyl N-(4-phenylphenyl)carbamate is used as a synthetic intermediate for the preparation of various organic compounds. Its unique structure allows for the creation of a wide range of derivatives, contributing to the advancement of organic synthesis.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2-furylmethyl N-(4-phenylphenyl)carbamate is utilized as a building block for the development of new pharmaceutical agents. Its potential role in medicinal chemistry includes the synthesis of drug candidates with specific therapeutic targets, thereby enhancing the discovery of novel treatments for various diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 6624-95-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,6,2 and 4 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 6624-95:
(6*6)+(5*6)+(4*2)+(3*4)+(2*9)+(1*5)=109
109 % 10 = 9
So 6624-95-9 is a valid CAS Registry Number.
InChI:InChI=1/C18H15NO3/c20-18(22-13-17-7-4-12-21-17)19-16-10-8-15(9-11-16)14-5-2-1-3-6-14/h1-12H,13H2,(H,19,20)