6635-66-1 Usage
Description
2-(dimethylamino)-6-oxo-3,6-dihydropyrimidine-4-carboxylic acid, also known as DMAP, is a versatile chemical compound with the molecular formula C8H10N2O3. It is widely recognized for its strong nucleophilic catalytic properties, which make it particularly effective in esterification and acylation reactions. DMAP facilitates the formation of acylated intermediates, enabling further reactions to yield the desired products. Its applications extend to the synthesis of pharmaceuticals, agrochemicals, and specialty chemicals, establishing it as a crucial reagent in organic synthesis.
Uses
Used in Organic Chemistry as a Catalyst:
DMAP is used as a catalyst in various organic chemistry reactions for its ability to enhance the rate of esterification and acylation processes. Its strong nucleophilic nature aids in the formation of acylated intermediates, which are essential for the synthesis of complex organic molecules.
Used in Pharmaceutical Synthesis:
In the pharmaceutical industry, DMAP is utilized as a catalyst in the synthesis of various drugs. Its effectiveness in promoting esterification and acylation reactions allows for the efficient production of pharmaceutical compounds, contributing to the development of new medications and therapies.
Used in Agrochemical Production:
DMAP also finds application in the agrochemical sector, where it serves as a catalyst in the synthesis of agrochemicals. Its role in facilitating key chemical reactions ensures the production of effective and efficient agrochemicals for agricultural use.
Used in Specialty Chemicals Synthesis:
Beyond pharmaceuticals and agrochemicals, DMAP is employed in the synthesis of specialty chemicals across various industries. Its versatility as a catalyst makes it a valuable tool in the production of a wide range of specialty chemicals, enhancing the efficiency and effectiveness of their synthesis processes.
Check Digit Verification of cas no
The CAS Registry Mumber 6635-66-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,6,3 and 5 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 6635-66:
(6*6)+(5*6)+(4*3)+(3*5)+(2*6)+(1*6)=111
111 % 10 = 1
So 6635-66-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H9N3O3/c1-10(2)7-8-4(6(12)13)3-5(11)9-7/h3H,1-2H3,(H,12,13)(H,8,9,11)
