6641-57-2 Usage
Description
[(4-methoxyphenyl)methylideneamino]carbamic acid is a chemical compound with the molecular formula C10H11NO4, derived from carbamic acid and featuring a phenyl group with a methoxy substituent. [(4-methoxyphenyl)methylideneamino]carbamic acid serves as a crucial building block in organic synthesis and pharmaceutical research, holding potential for the development of novel drugs and biologically active compounds.
Uses
Used in Pharmaceutical Research:
[(4-methoxyphenyl)methylideneamino]carbamic acid is used as a building block in pharmaceutical research for the development of new drugs and biologically active compounds. Its unique structure and properties make it a valuable component in the creation of various medicinal agents.
Used in Organic Synthesis:
In the field of organic synthesis, [(4-methoxyphenyl)methylideneamino]carbamic acid is utilized as a key intermediate for the synthesis of complex organic molecules. Its versatile structure allows for further functionalization and modification, contributing to the advancement of chemical research and innovation.
Safety Precautions:
Given the potential health risks associated with improper handling and storage, [(4-methoxyphenyl)methylideneamino]carbamic acid should be managed with care to ensure the safety of researchers and the environment. Proper safety protocols and guidelines should be followed to minimize any potential hazards.
Check Digit Verification of cas no
The CAS Registry Mumber 6641-57-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,6,4 and 1 respectively; the second part has 2 digits, 5 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 6641-57:
(6*6)+(5*6)+(4*4)+(3*1)+(2*5)+(1*7)=102
102 % 10 = 2
So 6641-57-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H10N2O3/c1-14-8-4-2-7(3-5-8)6-10-11-9(12)13/h2-6,11H,1H3,(H,12,13)/b10-6+
