6653-91-4 Usage
General Description
6-Hydrazinoimidazo[1,2-b]pyridazine is a chemical compound with the molecular formula C5H4N6. It is an imidazo[1,2-b]pyridazine derivative and contains a hydrazino group. 6-Hydrazinoimidazo[1,2-b]pyridazine has potential applications in pharmaceutical and chemical industries, particularly in the synthesis of heterocyclic compounds and drugs. It is also used as a building block in organic synthesis for the creation of various derivatives with potential biological activities. Additionally, 6-Hydrazinoimidazo[1,2-b]pyridazine has shown promise as a starting material for the development of new materials and functional molecules in the field of materials science. Its versatile properties and potential applications make it a valuable chemical compound in various scientific and industrial fields.
Check Digit Verification of cas no
The CAS Registry Mumber 6653-91-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,6,5 and 3 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 6653-91:
(6*6)+(5*6)+(4*5)+(3*3)+(2*9)+(1*1)=114
114 % 10 = 4
So 6653-91-4 is a valid CAS Registry Number.
InChI:InChI=1/C6H7N5/c7-9-5-1-2-6-8-3-4-11(6)10-5/h1-4H,7H2,(H,9,10)