683-85-2 Usage
Description
DIMETHYLPHOSPHORAMIDOUS DICHLORIDE, also known as N,N-dimethylamidodichlorophosphite, is an organophosphorus compound that serves as an important intermediate in the synthesis of various phosphorus-containing compounds. It is characterized by its reactivity and ability to form a wide range of products, making it a versatile building block in organic chemistry.
Uses
Used in Chemical Synthesis:
DIMETHYLPHOSPHORAMIDOUS DICHLORIDE is used as a synthetic intermediate for the production of various phosphorus-containing compounds. Its reactivity allows for the formation of a diverse range of products, making it a valuable component in the synthesis of complex molecules.
Used in the Synthesis of N,N-Dimethylamidotetrachlorophosphorane:
DIMETHYLPHOSPHORAMIDOUS DICHLORIDE is used as a precursor in the synthesis of N,N-dimethylamidotetrachlorophosphorane, a compound with potential applications in various chemical processes.
Used in the Synthesis of O-Propylchloroformimino-N,N-Dimethylamidochlorophosphate:
DIMETHYLPHOSPHORAMIDOUS DICHLORIDE is utilized as a starting material in the synthesis of O-propylchloroformimino-N,N-dimethylamidochlorophosphate, which may have specific uses in chemical reactions or as a component in various formulations.
Used in the Synthesis of 1,3-Bisarylsulphonyl-1,3,2,4-Diazadiphosphetidines:
DIMETHYLPHOSPHORAMIDOUS DICHLORIDE is employed as a key component in the synthesis of 1,3-bisarylsulphonyl-1,3,2,4-diazadiphosphetidines, a class of compounds with potential applications in various industries, such as pharmaceuticals or materials science, due to their unique properties and structures.
Check Digit Verification of cas no
The CAS Registry Mumber 683-85-2 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 6,8 and 3 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 683-85:
(5*6)+(4*8)+(3*3)+(2*8)+(1*5)=92
92 % 10 = 2
So 683-85-2 is a valid CAS Registry Number.
InChI:InChI=1/C2H6Cl2NP/c1-5(2)6(3)4/h1-2H3
