70555-24-7 Usage
Description
(2R)-2-amino-3-[(2R)-2-amino-3-(carboxymethylamino)-3-oxopropyl]disulfanylpropanoic acid is a complex organic molecule that is a derivative of the amino acid cysteine. It features a disulfanyl group and contains two chiral centers, resulting in two possible enantiomers. (2R)-2-amino-3-[(2R)-2-amino-3-(carboxymethylamino)-3-oxopropyl]disulfanylpropanoic acid is characterized by the presence of a carboxymethylamino group attached to a three-oxopropyl group, which allows for a broad spectrum of chemical reactions and applications in both organic and biochemistry research.
Uses
Used in Organic and Biochemistry Research:
(2R)-2-amino-3-[(2R)-2-amino-3-(carboxymethylamino)-3-oxopropyl]disulfanylpropanoic acid serves as a valuable building block for the synthesis of larger molecules and compounds. Its unique structure and functional groups make it a versatile component in the creation of new chemical entities with potential applications in various fields.
Used in Chemical Synthesis:
In the chemical synthesis industry, (2R)-2-amino-3-[(2R)-2-amino-3-(carboxymethylamino)-3-oxopropyl]disulfanylpropanoic acid is utilized for its ability to participate in a wide range of reactions due to its amino, carboxymethylamino, and disulfanyl groups. This makes it suitable for the development of novel compounds with specific properties for various applications.
Used in Pharmaceutical Development:
The complex structure of (2R)-2-amino-3-[(2R)-2-amino-3-(carboxymethylamino)-3-oxopropyl]disulfanylpropanoic acid lends itself to potential use in the pharmaceutical industry. It can be employed as a starting material for the development of new drugs, particularly those targeting specific biological pathways or mechanisms due to its reactive functional groups and chiral centers.
Used in Materials Science:
In materials science, (2R)-2-amino-3-[(2R)-2-amino-3-(carboxymethylamino)-3-oxopropyl]disulfanylpropanoic acid may be used to create new materials with unique properties. Its ability to form covalent bonds and interact with other molecules can lead to the development of advanced materials for use in various industries, such as electronics, textiles, or coatings.
Check Digit Verification of cas no
The CAS Registry Mumber 70555-24-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,0,5,5 and 5 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 70555-24:
(7*7)+(6*0)+(5*5)+(4*5)+(3*5)+(2*2)+(1*4)=117
117 % 10 = 7
So 70555-24-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H15N3O5S2/c9-4(7(14)11-1-6(12)13)2-17-18-3-5(10)8(15)16/h4-5H,1-3,9-10H2,(H,11,14)(H,12,13)(H,15,16)/t4-,5-/m0/s1