76-77-7 Usage
General Description
Picrasa-2,12-diene-1,11-dione, 16-hydroxy-2,12-dimethoxy- is a natural compound derived from the Picrasma quassioides plant, also known as the Chinese Picrasma tree. It is classified as a quassinoid, a class of bitter compounds with various biological activities. This particular chemical has been found to exhibit antimalarial, antiviral, and antitumor properties. Additionally, it has been studied for its potential as an anti-inflammatory and anti-osteoporotic agent. Its unique structure and biological activities make it a promising candidate for further research and potential therapeutic development.
Check Digit Verification of cas no
The CAS Registry Mumber 76-77-7 includes 5 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 2 digits, 7 and 6 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 76-77:
(4*7)+(3*6)+(2*7)+(1*7)=67
67 % 10 = 7
So 76-77-7 is a valid CAS Registry Number.
InChI:InChI=1/C22H30O6/c1-10-7-14(26-5)20(25)22(4)12(10)8-15-21(3)13(9-16(23)28-15)11(2)18(27-6)17(24)19(21)22/h7,10,12-13,15-16,19,23H,8-9H2,1-6H3